C24H28N4O — CID 123255041
7-ethyl-12,16-dimethyl-3,14,17,23-tetrazapentacyclo[13.6.2.12,5.04,9.018,22]tetracosa-1(22),2(24),4,15(23),16,18,20-heptaen-6-one (PubChem CID 123255041) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is 7-ethyl-12,16-dimethyl-3,14,17,23-tetrazapentacyclo[13.6.2.12,5.04,9.018,22]tetracosa-1(22),2(24),4,15(23),16,18,20-heptaen-6-one.
| Compound Name | 7-ethyl-12,16-dimethyl-3,14,17,23-tetrazapentacyclo[13.6.2.12,5.04,9.018,22]tetracosa-1(22),2(24),4,15(23),16,18,20-heptaen-6-one |
|---|---|
| PubChem CID | 123255041 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 7-ethyl-12,16-dimethyl-3,14,17,23-tetrazapentacyclo[13.6.2.12,5.04,9.018,22]tetracosa-1(22),2(24),4,15(23),16,18,20-heptaen-6-one |
| SMILES | CCC1CC2CCC(C)CNc3nc4c(cccc4nc3C)-c3cc(c2[nH]3)C1=O |
| InChI | InChI=1S/C24H28N4O/c1-4-15-10-16-9-8-13(2)12-25-24-14(3)26-19-7-5-6-17(22(19)28-24)20-11-18(23(15)29)21(16)27-20/h5-7,11,13,15-16,27H,4,8-10,12H2,1-3H3,(H,25,28) |
| InChIKey | XAXCWSSFYUDZFT-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |