C34H37ClFN3O6S — CID 123255159
2-chloro-N-[2-[1-[[4-(4-fluorophenyl)phenyl]methyl]-1-hydroxypiperidin-1-ium-4-yl]-4-methylphenyl]pyridine-4-carboxamide;3-hydroxypropane-1-sulfonate (PubChem CID 123255159) has the molecular formula C34H37ClFN3O6S and a molecular weight of 670.20 g/mol. Its IUPAC name is 2-chloro-N-[2-[1-[[4-(4-fluorophenyl)phenyl]methyl]-1-hydroxypiperidin-1-ium-4-yl]-4-methylphenyl]pyridine-4-carboxamide;3-hydroxypropane-1-sulfonate.
| Compound Name | 2-chloro-N-[2-[1-[[4-(4-fluorophenyl)phenyl]methyl]-1-hydroxypiperidin-1-ium-4-yl]-4-methylphenyl]pyridine-4-carboxamide;3-hydroxypropane-1-sulfonate |
|---|---|
| PubChem CID | 123255159 |
| Molecular Formula | C34H37ClFN3O6S |
| Molecular Weight | 670.20 g/mol |
| Exact Mass | 669.21 |
| IUPAC Name | 2-chloro-N-[2-[1-[[4-(4-fluorophenyl)phenyl]methyl]-1-hydroxypiperidin-1-ium-4-yl]-4-methylphenyl]pyridine-4-carboxamide;3-hydroxypropane-1-sulfonate |
| SMILES | Cc1ccc(NC(=O)c2ccnc(Cl)c2)c(C2CC[N+](O)(Cc3ccc(-c4ccc(F)cc4)cc3)CC2)c1.O=S(=O)([O-])CCCO |
| InChI | InChI=1S/C31H29ClFN3O2.C3H8O4S/c1-21-2-11-29(35-31(37)26-12-15-34-30(32)19-26)28(18-21)25-13-16-36(38,17-14-25)20-22-3-5-23(6-4-22)24-7-9-27(33)10-8-24;4-2-1-3-8(5,6)7/h2-12,15,18-19,25,38H,13-14,16-17,20H2,1H3;4H,1-3H2,(H,5,6,7) |
| InChIKey | DPQMZYPDFVISLX-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 139.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.20 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|