C12H18F2N4O8S — CID 123255371
[4,4-difluoro-2-(morpholin-3-ylmethoxycarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 123255371) has the molecular formula C12H18F2N4O8S and a molecular weight of 416.36 g/mol. Its IUPAC name is [4,4-difluoro-2-(morpholin-3-ylmethoxycarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [4,4-difluoro-2-(morpholin-3-ylmethoxycarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 123255371 |
| Molecular Formula | C12H18F2N4O8S |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | [4,4-difluoro-2-(morpholin-3-ylmethoxycarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C(NOCC1COCCN1)C1CC(F)(F)C2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C12H18F2N4O8S/c13-12(14)3-8(10(19)16-25-6-7-5-24-2-1-15-7)17-4-9(12)18(11(17)20)26-27(21,22)23/h7-9,15H,1-6H2,(H,16,19)(H,21,22,23) |
| InChIKey | VVHDOIPOWXYAFB-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 146.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|