About 2-[5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazol-1-yl]ethanesulfonamide
2-[5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazol-1-yl]ethanesulfonamide (PubChem CID 123255614) has the molecular formula C15H18F2N4O2S
and a molecular weight of 356.40 g/mol. Its IUPAC name is 2-[5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazol-1-yl]ethanesulfonamide.
Molecular Properties
| Compound Name | 2-[5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazol-1-yl]ethanesulfonamide |
| PubChem CID | 123255614 |
| Molecular Formula | C15H18F2N4O2S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 2-[5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazol-1-yl]ethanesulfonamide |
| SMILES | NS(=O)(=O)CCn1nccc1N1CCC[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C15H18F2N4O2S/c16-11-3-4-13(17)12(10-11)14-2-1-7-20(14)15-5-6-19-21(15)8-9-24(18,22)23/h3-6,10,14H,1-2,7-9H2,(H2,18,22,23)/t14-/m1/s1 |
| InChIKey | VUIRBPBHQQERTA-CQSZACIVSA-N |
| XLogP | 1.79 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazol-1-yl]ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazol-1-yl]ethanesulfonamide?
The IUPAC name of 2-[5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazol-1-yl]ethanesulfonamide (CID 123255614) is 2-[5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazol-1-yl]ethanesulfonamide.
What is the SMILES notation for 2-[5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazol-1-yl]ethanesulfonamide?
The canonical SMILES for 2-[5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazol-1-yl]ethanesulfonamide is NS(=O)(=O)CCn1nccc1N1CCC[C@@H]1c1cc(F)ccc1F.
What is the InChIKey of 2-[5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazol-1-yl]ethanesulfonamide?
The InChIKey is VUIRBPBHQQERTA-CQSZACIVSA-N. The full InChI is InChI=1S/C15H18F2N4O2S/c16-11-3-4-13(17)12(10-11)14-2-1-7-20(14)15-5-6-19-21(15)8-9-24(18,22)23/h3-6,10,14H,1-2,7-9H2,(H2,18,22,23)/t14-/m1/s1.
What are the key properties of 2-[5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazol-1-yl]ethanesulfonamide?
2-[5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazol-1-yl]ethanesulfonamide has a molecular weight of 356.40 g/mol, XLogP of 1.79, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazol-1-yl]ethanesulfonamide is sourced from PubChem (CID 123255614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).