C19H30N2OSSi — CID 123255632
tert-butyl-[4-[(9S)-3,4,6,7,8,9-hexahydropyrido[2,1-c][1,2,4]thiadiazin-9-yl]phenoxy]-dimethylsilane (PubChem CID 123255632) has the molecular formula C19H30N2OSSi and a molecular weight of 362.62 g/mol. Its IUPAC name is tert-butyl-[4-[(9S)-3,4,6,7,8,9-hexahydropyrido[2,1-c][1,2,4]thiadiazin-9-yl]phenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[4-[(9S)-3,4,6,7,8,9-hexahydropyrido[2,1-c][1,2,4]thiadiazin-9-yl]phenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 123255632 |
| Molecular Formula | C19H30N2OSSi |
| Molecular Weight | 362.62 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | tert-butyl-[4-[(9S)-3,4,6,7,8,9-hexahydropyrido[2,1-c][1,2,4]thiadiazin-9-yl]phenoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc([C@@H]2CCCN3CCSN=C23)cc1 |
| InChI | InChI=1S/C19H30N2OSSi/c1-19(2,3)24(4,5)22-16-10-8-15(9-11-16)17-7-6-12-21-13-14-23-20-18(17)21/h8-11,17H,6-7,12-14H2,1-5H3/t17-/m0/s1 |
| InChIKey | ZHLGJQHTLNESMJ-KRWDZBQOSA-N |
| XLogP | 5.31 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.62 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|