C24H22FNO4S — CID 123255678
8-(4-fluorophenyl)sulfanyl-3,4-dihydroxy-13-methoxy-10-methyl-10-azapentacyclo[7.6.1.11,11.02,7.011,16]heptadeca-2(7),3,5,12-tetraen-14-one (PubChem CID 123255678) has the molecular formula C24H22FNO4S and a molecular weight of 439.51 g/mol. Its IUPAC name is 8-(4-fluorophenyl)sulfanyl-3,4-dihydroxy-13-methoxy-10-methyl-10-azapentacyclo[7.6.1.11,11.02,7.011,16]heptadeca-2(7),3,5,12-tetraen-14-one.
| Compound Name | 8-(4-fluorophenyl)sulfanyl-3,4-dihydroxy-13-methoxy-10-methyl-10-azapentacyclo[7.6.1.11,11.02,7.011,16]heptadeca-2(7),3,5,12-tetraen-14-one |
|---|---|
| PubChem CID | 123255678 |
| Molecular Formula | C24H22FNO4S |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 8-(4-fluorophenyl)sulfanyl-3,4-dihydroxy-13-methoxy-10-methyl-10-azapentacyclo[7.6.1.11,11.02,7.011,16]heptadeca-2(7),3,5,12-tetraen-14-one |
| SMILES | COC1=CC23CC4(CC1=O)c1c(ccc(O)c1O)C(Sc1ccc(F)cc1)C(C42)N3C |
| InChI | InChI=1S/C24H22FNO4S/c1-26-19-21(31-13-5-3-12(25)4-6-13)14-7-8-15(27)20(29)18(14)23-9-16(28)17(30-2)10-24(26,11-23)22(19)23/h3-8,10,19,21-22,27,29H,9,11H2,1-2H3 |
| InChIKey | YSRZIPBOWIQJMF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|