About 6-(2-pyridin-3-yl-1,3-thiazol-5-yl)-4-pyrimidin-2-ylthieno[3,2-c]pyridine
6-(2-pyridin-3-yl-1,3-thiazol-5-yl)-4-pyrimidin-2-ylthieno[3,2-c]pyridine (PubChem CID 123256046) has the molecular formula C19H11N5S2
and a molecular weight of 373.47 g/mol. Its IUPAC name is 6-(2-pyridin-3-yl-1,3-thiazol-5-yl)-4-pyrimidin-2-ylthieno[3,2-c]pyridine.
Molecular Properties
| Compound Name | 6-(2-pyridin-3-yl-1,3-thiazol-5-yl)-4-pyrimidin-2-ylthieno[3,2-c]pyridine |
| PubChem CID | 123256046 |
| Molecular Formula | C19H11N5S2 |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 6-(2-pyridin-3-yl-1,3-thiazol-5-yl)-4-pyrimidin-2-ylthieno[3,2-c]pyridine |
| SMILES | c1cnc(-c2nc(-c3cnc(-c4cccnc4)s3)cc3sccc23)nc1 |
| InChI | InChI=1S/C19H11N5S2/c1-3-12(10-20-5-1)19-23-11-16(26-19)14-9-15-13(4-8-25-15)17(24-14)18-21-6-2-7-22-18/h1-11H |
| InChIKey | UJMVACYRDYAPNQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-(2-pyridin-3-yl-1,3-thiazol-5-yl)-4-pyrimidin-2-ylthieno[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-pyridin-3-yl-1,3-thiazol-5-yl)-4-pyrimidin-2-ylthieno[3,2-c]pyridine?
The IUPAC name of 6-(2-pyridin-3-yl-1,3-thiazol-5-yl)-4-pyrimidin-2-ylthieno[3,2-c]pyridine (CID 123256046) is 6-(2-pyridin-3-yl-1,3-thiazol-5-yl)-4-pyrimidin-2-ylthieno[3,2-c]pyridine.
What is the SMILES notation for 6-(2-pyridin-3-yl-1,3-thiazol-5-yl)-4-pyrimidin-2-ylthieno[3,2-c]pyridine?
The canonical SMILES for 6-(2-pyridin-3-yl-1,3-thiazol-5-yl)-4-pyrimidin-2-ylthieno[3,2-c]pyridine is c1cnc(-c2nc(-c3cnc(-c4cccnc4)s3)cc3sccc23)nc1.
What is the InChIKey of 6-(2-pyridin-3-yl-1,3-thiazol-5-yl)-4-pyrimidin-2-ylthieno[3,2-c]pyridine?
The InChIKey is UJMVACYRDYAPNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11N5S2/c1-3-12(10-20-5-1)19-23-11-16(26-19)14-9-15-13(4-8-25-15)17(24-14)18-21-6-2-7-22-18/h1-11H.
What are the key properties of 6-(2-pyridin-3-yl-1,3-thiazol-5-yl)-4-pyrimidin-2-ylthieno[3,2-c]pyridine?
6-(2-pyridin-3-yl-1,3-thiazol-5-yl)-4-pyrimidin-2-ylthieno[3,2-c]pyridine has a molecular weight of 373.47 g/mol, XLogP of 4.94, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-pyridin-3-yl-1,3-thiazol-5-yl)-4-pyrimidin-2-ylthieno[3,2-c]pyridine is sourced from PubChem (CID 123256046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).