C8H17N5O — CID 123256261
N'-(N,N-dimethylcarbamimidoyl)morpholine-4-carboximidamide (PubChem CID 123256261) has the molecular formula C8H17N5O and a molecular weight of 199.26 g/mol. Its IUPAC name is N'-(N,N-dimethylcarbamimidoyl)morpholine-4-carboximidamide.
| Compound Name | N'-(N,N-dimethylcarbamimidoyl)morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 123256261 |
| Molecular Formula | C8H17N5O |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | N'-(N,N-dimethylcarbamimidoyl)morpholine-4-carboximidamide |
| SMILES | [H]/N=C(/N=C(N)N1CCOCC1)N(C)C |
| InChI | InChI=1S/C8H17N5O/c1-12(2)7(9)11-8(10)13-3-5-14-6-4-13/h3-6H2,1-2H3,(H3,9,10,11) |
| InChIKey | SZVSHWYRXRURFC-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 77.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|