About 5-but-1-enyl-5-methyl-1,4-diazepine
5-but-1-enyl-5-methyl-1,4-diazepine (PubChem CID 123256300) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 5-but-1-enyl-5-methyl-1,4-diazepine.
Molecular Properties
| Compound Name | 5-but-1-enyl-5-methyl-1,4-diazepine |
| PubChem CID | 123256300 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 5-but-1-enyl-5-methyl-1,4-diazepine |
| SMILES | CCC=CC1(C)C=CN=CC=N1 |
| InChI | InChI=1S/C10H14N2/c1-3-4-5-10(2)6-7-11-8-9-12-10/h4-9H,3H2,1-2H3 |
| InChIKey | WBCKKLRDGOKSOB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-but-1-enyl-5-methyl-1,4-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-but-1-enyl-5-methyl-1,4-diazepine?
The IUPAC name of 5-but-1-enyl-5-methyl-1,4-diazepine (CID 123256300) is 5-but-1-enyl-5-methyl-1,4-diazepine.
What is the SMILES notation for 5-but-1-enyl-5-methyl-1,4-diazepine?
The canonical SMILES for 5-but-1-enyl-5-methyl-1,4-diazepine is CCC=CC1(C)C=CN=CC=N1.
What is the InChIKey of 5-but-1-enyl-5-methyl-1,4-diazepine?
The InChIKey is WBCKKLRDGOKSOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-3-4-5-10(2)6-7-11-8-9-12-10/h4-9H,3H2,1-2H3.
What are the key properties of 5-but-1-enyl-5-methyl-1,4-diazepine?
5-but-1-enyl-5-methyl-1,4-diazepine has a molecular weight of 162.24 g/mol, XLogP of 2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-but-1-enyl-5-methyl-1,4-diazepine is sourced from PubChem (CID 123256300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).