About 7-chloro-2,3-dimethoxy-5-nitro-6-(trifluoromethyl)quinoxalin-4-ium
7-chloro-2,3-dimethoxy-5-nitro-6-(trifluoromethyl)quinoxalin-4-ium (PubChem CID 123256320) has the molecular formula C11H8ClF3N3O4+
and a molecular weight of 338.65 g/mol. Its IUPAC name is 7-chloro-2,3-dimethoxy-5-nitro-6-(trifluoromethyl)quinoxalin-4-ium.
Molecular Properties
| Compound Name | 7-chloro-2,3-dimethoxy-5-nitro-6-(trifluoromethyl)quinoxalin-4-ium |
| PubChem CID | 123256320 |
| Molecular Formula | C11H8ClF3N3O4+ |
| Molecular Weight | 338.65 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 7-chloro-2,3-dimethoxy-5-nitro-6-(trifluoromethyl)quinoxalin-4-ium |
| SMILES | COc1nc2cc(Cl)c(C(F)(F)F)c([N+](=O)[O-])c2[nH+]c1OC |
| InChI | InChI=1S/C11H7ClF3N3O4/c1-21-9-10(22-2)17-7-5(16-9)3-4(12)6(11(13,14)15)8(7)18(19)20/h3H,1-2H3/p+1 |
| InChIKey | STTZUAFKMQQHQF-UHFFFAOYSA-O |
| XLogP | 2.65 |
| TPSA | 88.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.65 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-2,3-dimethoxy-5-nitro-6-(trifluoromethyl)quinoxalin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2,3-dimethoxy-5-nitro-6-(trifluoromethyl)quinoxalin-4-ium?
The IUPAC name of 7-chloro-2,3-dimethoxy-5-nitro-6-(trifluoromethyl)quinoxalin-4-ium (CID 123256320) is 7-chloro-2,3-dimethoxy-5-nitro-6-(trifluoromethyl)quinoxalin-4-ium.
What is the SMILES notation for 7-chloro-2,3-dimethoxy-5-nitro-6-(trifluoromethyl)quinoxalin-4-ium?
The canonical SMILES for 7-chloro-2,3-dimethoxy-5-nitro-6-(trifluoromethyl)quinoxalin-4-ium is COc1nc2cc(Cl)c(C(F)(F)F)c([N+](=O)[O-])c2[nH+]c1OC.
What is the InChIKey of 7-chloro-2,3-dimethoxy-5-nitro-6-(trifluoromethyl)quinoxalin-4-ium?
The InChIKey is STTZUAFKMQQHQF-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H7ClF3N3O4/c1-21-9-10(22-2)17-7-5(16-9)3-4(12)6(11(13,14)15)8(7)18(19)20/h3H,1-2H3/p+1.
What are the key properties of 7-chloro-2,3-dimethoxy-5-nitro-6-(trifluoromethyl)quinoxalin-4-ium?
7-chloro-2,3-dimethoxy-5-nitro-6-(trifluoromethyl)quinoxalin-4-ium has a molecular weight of 338.65 g/mol, XLogP of 2.65, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2,3-dimethoxy-5-nitro-6-(trifluoromethyl)quinoxalin-4-ium is sourced from PubChem (CID 123256320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).