C36H41N5O5S — CID 123256338
tert-butyl N-[(2S)-1-[[(2S)-1-[1-benzofuran-5-ylmethyl-(2-ethylimino-3-sulfanylidenepropyl)amino]-1-oxo-3-phenylpropan-2-yl]amino]-1-oxo-3-pyridin-3-ylpropan-2-yl]carbamate (PubChem CID 123256338) has the molecular formula C36H41N5O5S and a molecular weight of 655.82 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(2S)-1-[1-benzofuran-5-ylmethyl-(2-ethylimino-3-sulfanylidenepropyl)amino]-1-oxo-3-phenylpropan-2-yl]amino]-1-oxo-3-pyridin-3-ylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(2S)-1-[1-benzofuran-5-ylmethyl-(2-ethylimino-3-sulfanylidenepropyl)amino]-1-oxo-3-phenylpropan-2-yl]amino]-1-oxo-3-pyridin-3-ylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 123256338 |
| Molecular Formula | C36H41N5O5S |
| Molecular Weight | 655.82 g/mol |
| Exact Mass | 655.28 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(2S)-1-[1-benzofuran-5-ylmethyl-(2-ethylimino-3-sulfanylidenepropyl)amino]-1-oxo-3-phenylpropan-2-yl]amino]-1-oxo-3-pyridin-3-ylpropan-2-yl]carbamate |
| SMILES | CC/N=C(\C=S)CN(Cc1ccc2occc2c1)C(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1cccnc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H41N5O5S/c1-5-38-29(24-47)23-41(22-27-13-14-32-28(18-27)15-17-45-32)34(43)31(19-25-10-7-6-8-11-25)39-33(42)30(20-26-12-9-16-37-21-26)40-35(44)46-36(2,3)4/h6-18,21,24,30-31H,5,19-20,22-23H2,1-4H3,(H,39,42)(H,40,44)/b38-29-/t30-,31-/m0/s1 |
| InChIKey | MSVFXFIRKFGFSB-IEXNDWPXSA-N |
| XLogP | 5.48 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.82 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|