C15H28N2O — CID 123256546
2-ethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)but-3-enamide (PubChem CID 123256546) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is 2-ethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)but-3-enamide.
| Compound Name | 2-ethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)but-3-enamide |
|---|---|
| PubChem CID | 123256546 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 2-ethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)but-3-enamide |
| SMILES | C=CC(CC)C(=O)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C15H28N2O/c1-7-11(8-2)13(18)16-12-9-14(3,4)17-15(5,6)10-12/h7,11-12,17H,1,8-10H2,2-6H3,(H,16,18) |
| InChIKey | SQJRPAHRCHDUTF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|