About [4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl] 3-hydroxy-N-(2-methyliminoethyl)butanimidate
[4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl] 3-hydroxy-N-(2-methyliminoethyl)butanimidate (PubChem CID 123256772) has the molecular formula C18H26BrN5O2
and a molecular weight of 424.34 g/mol. Its IUPAC name is [4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl] 3-hydroxy-N-(2-methyliminoethyl)butanimidate.
Molecular Properties
| Compound Name | [4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl] 3-hydroxy-N-(2-methyliminoethyl)butanimidate |
| PubChem CID | 123256772 |
| Molecular Formula | C18H26BrN5O2 |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | [4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl] 3-hydroxy-N-(2-methyliminoethyl)butanimidate |
| SMILES | C/N=C/C/N=C(\CC(C)O)Oc1ccc2c(nnn2CC(C)(C)C)c1Br |
| InChI | InChI=1S/C18H26BrN5O2/c1-12(25)10-15(21-9-8-20-5)26-14-7-6-13-17(16(14)19)22-23-24(13)11-18(2,3)4/h6-8,12,25H,9-11H2,1-5H3/b20-8+,21-15+ |
| InChIKey | MQDRJRNRETVPOY-BEPYMYGUSA-N |
| XLogP | 3.49 |
| TPSA | 84.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl] 3-hydroxy-N-(2-methyliminoethyl)butanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl] 3-hydroxy-N-(2-methyliminoethyl)butanimidate?
The IUPAC name of [4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl] 3-hydroxy-N-(2-methyliminoethyl)butanimidate (CID 123256772) is [4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl] 3-hydroxy-N-(2-methyliminoethyl)butanimidate.
What is the SMILES notation for [4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl] 3-hydroxy-N-(2-methyliminoethyl)butanimidate?
The canonical SMILES for [4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl] 3-hydroxy-N-(2-methyliminoethyl)butanimidate is C/N=C/C/N=C(\CC(C)O)Oc1ccc2c(nnn2CC(C)(C)C)c1Br.
What is the InChIKey of [4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl] 3-hydroxy-N-(2-methyliminoethyl)butanimidate?
The InChIKey is MQDRJRNRETVPOY-BEPYMYGUSA-N. The full InChI is InChI=1S/C18H26BrN5O2/c1-12(25)10-15(21-9-8-20-5)26-14-7-6-13-17(16(14)19)22-23-24(13)11-18(2,3)4/h6-8,12,25H,9-11H2,1-5H3/b20-8+,21-15+.
What are the key properties of [4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl] 3-hydroxy-N-(2-methyliminoethyl)butanimidate?
[4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl] 3-hydroxy-N-(2-methyliminoethyl)butanimidate has a molecular weight of 424.34 g/mol, XLogP of 3.49, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl] 3-hydroxy-N-(2-methyliminoethyl)butanimidate is sourced from PubChem (CID 123256772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).