About 1-(4-ethynylcyclohexa-1,5-dien-1-yl)ethyl-methylidyneazanium
1-(4-ethynylcyclohexa-1,5-dien-1-yl)ethyl-methylidyneazanium (PubChem CID 123256842) has the molecular formula C11H12N+
and a molecular weight of 158.22 g/mol. Its IUPAC name is 1-(4-ethynylcyclohexa-1,5-dien-1-yl)ethyl-methylidyneazanium.
Molecular Properties
| Compound Name | 1-(4-ethynylcyclohexa-1,5-dien-1-yl)ethyl-methylidyneazanium |
| PubChem CID | 123256842 |
| Molecular Formula | C11H12N+ |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.10 |
| IUPAC Name | 1-(4-ethynylcyclohexa-1,5-dien-1-yl)ethyl-methylidyneazanium |
| SMILES | C#CC1C=CC(C(C)[N+]#C)=CC1 |
| InChI | InChI=1S/C11H12N/c1-4-10-5-7-11(8-6-10)9(2)12-3/h1,3,5,7-10H,6H2,2H3/q+1 |
| InChIKey | HWOURTBFRQNGPB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-ethynylcyclohexa-1,5-dien-1-yl)ethyl-methylidyneazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethynylcyclohexa-1,5-dien-1-yl)ethyl-methylidyneazanium?
The IUPAC name of 1-(4-ethynylcyclohexa-1,5-dien-1-yl)ethyl-methylidyneazanium (CID 123256842) is 1-(4-ethynylcyclohexa-1,5-dien-1-yl)ethyl-methylidyneazanium.
What is the SMILES notation for 1-(4-ethynylcyclohexa-1,5-dien-1-yl)ethyl-methylidyneazanium?
The canonical SMILES for 1-(4-ethynylcyclohexa-1,5-dien-1-yl)ethyl-methylidyneazanium is C#CC1C=CC(C(C)[N+]#C)=CC1.
What is the InChIKey of 1-(4-ethynylcyclohexa-1,5-dien-1-yl)ethyl-methylidyneazanium?
The InChIKey is HWOURTBFRQNGPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N/c1-4-10-5-7-11(8-6-10)9(2)12-3/h1,3,5,7-10H,6H2,2H3/q+1.
What are the key properties of 1-(4-ethynylcyclohexa-1,5-dien-1-yl)ethyl-methylidyneazanium?
1-(4-ethynylcyclohexa-1,5-dien-1-yl)ethyl-methylidyneazanium has a molecular weight of 158.22 g/mol, XLogP of 2.47, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethynylcyclohexa-1,5-dien-1-yl)ethyl-methylidyneazanium is sourced from PubChem (CID 123256842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).