C20H32F2N2O3 — CID 123256884
[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-[(1S,3S)-1-(2,2-difluoroethyl)-3-[[(3S,4S)-3-methoxyoxan-4-yl]methyl]cyclopentyl]methanone (PubChem CID 123256884) has the molecular formula C20H32F2N2O3 and a molecular weight of 386.48 g/mol. Its IUPAC name is [(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-[(1S,3S)-1-(2,2-difluoroethyl)-3-[[(3S,4S)-3-methoxyoxan-4-yl]methyl]cyclopentyl]methanone.
| Compound Name | [(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-[(1S,3S)-1-(2,2-difluoroethyl)-3-[[(3S,4S)-3-methoxyoxan-4-yl]methyl]cyclopentyl]methanone |
|---|---|
| PubChem CID | 123256884 |
| Molecular Formula | C20H32F2N2O3 |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | [(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-[(1S,3S)-1-(2,2-difluoroethyl)-3-[[(3S,4S)-3-methoxyoxan-4-yl]methyl]cyclopentyl]methanone |
| SMILES | CO[C@@H]1COCC[C@@H]1C[C@@H]1CC[C@](CC(F)F)(C(=O)N2C[C@@H]3C[C@H]2CN3)C1 |
| InChI | InChI=1S/C20H32F2N2O3/c1-26-17-12-27-5-3-14(17)6-13-2-4-20(8-13,9-18(21)22)19(25)24-11-15-7-16(24)10-23-15/h13-18,23H,2-12H2,1H3/t13-,14+,15-,16-,17+,20-/m0/s1 |
| InChIKey | YFLYETZNAVXVOY-ZYABLZSBSA-N |
| XLogP | 2.44 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |