About 3-tert-butyl-6-methyl-1-azacyclohepta-2,4,5,7-tetraene
3-tert-butyl-6-methyl-1-azacyclohepta-2,4,5,7-tetraene (PubChem CID 123257059) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is 3-tert-butyl-6-methyl-1-azacyclohepta-2,4,5,7-tetraene.
Molecular Properties
| Compound Name | 3-tert-butyl-6-methyl-1-azacyclohepta-2,4,5,7-tetraene |
| PubChem CID | 123257059 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 3-tert-butyl-6-methyl-1-azacyclohepta-2,4,5,7-tetraene |
| SMILES | CC1=C=CC(C(C)(C)C)=CN=C1 |
| InChI | InChI=1S/C11H15N/c1-9-5-6-10(8-12-7-9)11(2,3)4/h6-8H,1-4H3 |
| InChIKey | MESKFYCIICFKHQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-tert-butyl-6-methyl-1-azacyclohepta-2,4,5,7-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-6-methyl-1-azacyclohepta-2,4,5,7-tetraene?
The IUPAC name of 3-tert-butyl-6-methyl-1-azacyclohepta-2,4,5,7-tetraene (CID 123257059) is 3-tert-butyl-6-methyl-1-azacyclohepta-2,4,5,7-tetraene.
What is the SMILES notation for 3-tert-butyl-6-methyl-1-azacyclohepta-2,4,5,7-tetraene?
The canonical SMILES for 3-tert-butyl-6-methyl-1-azacyclohepta-2,4,5,7-tetraene is CC1=C=CC(C(C)(C)C)=CN=C1.
What is the InChIKey of 3-tert-butyl-6-methyl-1-azacyclohepta-2,4,5,7-tetraene?
The InChIKey is MESKFYCIICFKHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N/c1-9-5-6-10(8-12-7-9)11(2,3)4/h6-8H,1-4H3.
What are the key properties of 3-tert-butyl-6-methyl-1-azacyclohepta-2,4,5,7-tetraene?
3-tert-butyl-6-methyl-1-azacyclohepta-2,4,5,7-tetraene has a molecular weight of 161.25 g/mol, XLogP of 3.10, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-6-methyl-1-azacyclohepta-2,4,5,7-tetraene is sourced from PubChem (CID 123257059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).