About (Z)-2-fluoro-N,4-dimethylhex-4-en-3-imine
(Z)-2-fluoro-N,4-dimethylhex-4-en-3-imine (PubChem CID 123257135) has the molecular formula C8H14FN
and a molecular weight of 143.20 g/mol. Its IUPAC name is (Z)-2-fluoro-N,4-dimethylhex-4-en-3-imine.
Molecular Properties
| Compound Name | (Z)-2-fluoro-N,4-dimethylhex-4-en-3-imine |
| PubChem CID | 123257135 |
| Molecular Formula | C8H14FN |
| Molecular Weight | 143.20 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | (Z)-2-fluoro-N,4-dimethylhex-4-en-3-imine |
| SMILES | C/C=C(C)\C(=N\C)C(C)F |
| InChI | InChI=1S/C8H14FN/c1-5-6(2)8(10-4)7(3)9/h5,7H,1-4H3/b6-5-,10-8- |
| InChIKey | SXGHXGUTMYDKNE-XUTLIFGGSA-N |
| XLogP | 2.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.20 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-fluoro-N,4-dimethylhex-4-en-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-fluoro-N,4-dimethylhex-4-en-3-imine?
The IUPAC name of (Z)-2-fluoro-N,4-dimethylhex-4-en-3-imine (CID 123257135) is (Z)-2-fluoro-N,4-dimethylhex-4-en-3-imine.
What is the SMILES notation for (Z)-2-fluoro-N,4-dimethylhex-4-en-3-imine?
The canonical SMILES for (Z)-2-fluoro-N,4-dimethylhex-4-en-3-imine is C/C=C(C)\C(=N\C)C(C)F.
What is the InChIKey of (Z)-2-fluoro-N,4-dimethylhex-4-en-3-imine?
The InChIKey is SXGHXGUTMYDKNE-XUTLIFGGSA-N. The full InChI is InChI=1S/C8H14FN/c1-5-6(2)8(10-4)7(3)9/h5,7H,1-4H3/b6-5-,10-8-.
What are the key properties of (Z)-2-fluoro-N,4-dimethylhex-4-en-3-imine?
(Z)-2-fluoro-N,4-dimethylhex-4-en-3-imine has a molecular weight of 143.20 g/mol, XLogP of 2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-fluoro-N,4-dimethylhex-4-en-3-imine is sourced from PubChem (CID 123257135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).