C14H24O2 — CID 123257277
4-(2,2,4-trimethylpentan-3-yl)cyclohexane-1,2-dione (PubChem CID 123257277) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 4-(2,2,4-trimethylpentan-3-yl)cyclohexane-1,2-dione.
| Compound Name | 4-(2,2,4-trimethylpentan-3-yl)cyclohexane-1,2-dione |
|---|---|
| PubChem CID | 123257277 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 4-(2,2,4-trimethylpentan-3-yl)cyclohexane-1,2-dione |
| SMILES | CC(C)C(C1CCC(=O)C(=O)C1)C(C)(C)C |
| InChI | InChI=1S/C14H24O2/c1-9(2)13(14(3,4)5)10-6-7-11(15)12(16)8-10/h9-10,13H,6-8H2,1-5H3 |
| InChIKey | WZSDVTIUXJPBQP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|