C23H22F2N5O2+ — CID 123257634
3-(2,2-difluoro-1,3-benzodioxol-4-yl)-5-(1-methyl-2-piperidin-4-ylpyrazol-1-ium-4-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 123257634) has the molecular formula C23H22F2N5O2+ and a molecular weight of 438.46 g/mol. Its IUPAC name is 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-5-(1-methyl-2-piperidin-4-ylpyrazol-1-ium-4-yl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-5-(1-methyl-2-piperidin-4-ylpyrazol-1-ium-4-yl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 123257634 |
| Molecular Formula | C23H22F2N5O2+ |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-5-(1-methyl-2-piperidin-4-ylpyrazol-1-ium-4-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | C[n+]1cc(-c2cnc3[nH]cc(-c4cccc5c4OC(F)(F)O5)c3c2)cn1C1CCNCC1 |
| InChI | InChI=1S/C23H22F2N5O2/c1-29-12-15(13-30(29)16-5-7-26-8-6-16)14-9-18-19(11-28-22(18)27-10-14)17-3-2-4-20-21(17)32-23(24,25)31-20/h2-4,9-13,16,26H,5-8H2,1H3,(H,27,28)/q+1 |
| InChIKey | IBUODDVJSSCRHB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|