About (4-methylcyclohexa-1,5-dien-1-yl)methyldiazene
(4-methylcyclohexa-1,5-dien-1-yl)methyldiazene (PubChem CID 123257798) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is (4-methylcyclohexa-1,5-dien-1-yl)methyldiazene.
Molecular Properties
| Compound Name | (4-methylcyclohexa-1,5-dien-1-yl)methyldiazene |
| PubChem CID | 123257798 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (4-methylcyclohexa-1,5-dien-1-yl)methyldiazene |
| SMILES | [H]/N=N/CC1=CCC(C)C=C1 |
| InChI | InChI=1S/C8H12N2/c1-7-2-4-8(5-3-7)6-10-9/h2,4-5,7,9H,3,6H2,1H3/b10-9+ |
| InChIKey | TUPIPCSJKYZCAW-MDZDMXLPSA-N |
| XLogP | 2.54 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze (4-methylcyclohexa-1,5-dien-1-yl)methyldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylcyclohexa-1,5-dien-1-yl)methyldiazene?
The IUPAC name of (4-methylcyclohexa-1,5-dien-1-yl)methyldiazene (CID 123257798) is (4-methylcyclohexa-1,5-dien-1-yl)methyldiazene.
What is the SMILES notation for (4-methylcyclohexa-1,5-dien-1-yl)methyldiazene?
The canonical SMILES for (4-methylcyclohexa-1,5-dien-1-yl)methyldiazene is [H]/N=N/CC1=CCC(C)C=C1.
What is the InChIKey of (4-methylcyclohexa-1,5-dien-1-yl)methyldiazene?
The InChIKey is TUPIPCSJKYZCAW-MDZDMXLPSA-N. The full InChI is InChI=1S/C8H12N2/c1-7-2-4-8(5-3-7)6-10-9/h2,4-5,7,9H,3,6H2,1H3/b10-9+.
What are the key properties of (4-methylcyclohexa-1,5-dien-1-yl)methyldiazene?
(4-methylcyclohexa-1,5-dien-1-yl)methyldiazene has a molecular weight of 136.20 g/mol, XLogP of 2.54, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylcyclohexa-1,5-dien-1-yl)methyldiazene is sourced from PubChem (CID 123257798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).