About 2-chloro-6-methyl-4-(trifluoromethyl)-2,3-dihydropyridine
2-chloro-6-methyl-4-(trifluoromethyl)-2,3-dihydropyridine (PubChem CID 123257853) has the molecular formula C7H7ClF3N
and a molecular weight of 197.59 g/mol. Its IUPAC name is 2-chloro-6-methyl-4-(trifluoromethyl)-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 2-chloro-6-methyl-4-(trifluoromethyl)-2,3-dihydropyridine |
| PubChem CID | 123257853 |
| Molecular Formula | C7H7ClF3N |
| Molecular Weight | 197.59 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | 2-chloro-6-methyl-4-(trifluoromethyl)-2,3-dihydropyridine |
| SMILES | CC1=NC(Cl)CC(C(F)(F)F)=C1 |
| InChI | InChI=1S/C7H7ClF3N/c1-4-2-5(7(9,10)11)3-6(8)12-4/h2,6H,3H2,1H3 |
| InChIKey | CEVNJRPJJABERX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.59 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6-methyl-4-(trifluoromethyl)-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-methyl-4-(trifluoromethyl)-2,3-dihydropyridine?
The IUPAC name of 2-chloro-6-methyl-4-(trifluoromethyl)-2,3-dihydropyridine (CID 123257853) is 2-chloro-6-methyl-4-(trifluoromethyl)-2,3-dihydropyridine.
What is the SMILES notation for 2-chloro-6-methyl-4-(trifluoromethyl)-2,3-dihydropyridine?
The canonical SMILES for 2-chloro-6-methyl-4-(trifluoromethyl)-2,3-dihydropyridine is CC1=NC(Cl)CC(C(F)(F)F)=C1.
What is the InChIKey of 2-chloro-6-methyl-4-(trifluoromethyl)-2,3-dihydropyridine?
The InChIKey is CEVNJRPJJABERX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClF3N/c1-4-2-5(7(9,10)11)3-6(8)12-4/h2,6H,3H2,1H3.
What are the key properties of 2-chloro-6-methyl-4-(trifluoromethyl)-2,3-dihydropyridine?
2-chloro-6-methyl-4-(trifluoromethyl)-2,3-dihydropyridine has a molecular weight of 197.59 g/mol, XLogP of 2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-methyl-4-(trifluoromethyl)-2,3-dihydropyridine is sourced from PubChem (CID 123257853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).