C19H23BFN3O5 — CID 123258381
2-[3,4-bis(aminomethyl)-5-fluorophenyl]-N-[8-(dihydroxymethyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]acetamide (PubChem CID 123258381) has the molecular formula C19H23BFN3O5 and a molecular weight of 403.22 g/mol. Its IUPAC name is 2-[3,4-bis(aminomethyl)-5-fluorophenyl]-N-[8-(dihydroxymethyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]acetamide.
| Compound Name | 2-[3,4-bis(aminomethyl)-5-fluorophenyl]-N-[8-(dihydroxymethyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]acetamide |
|---|---|
| PubChem CID | 123258381 |
| Molecular Formula | C19H23BFN3O5 |
| Molecular Weight | 403.22 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 2-[3,4-bis(aminomethyl)-5-fluorophenyl]-N-[8-(dihydroxymethyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]acetamide |
| SMILES | NCc1cc(CC(=O)NC2Cc3cccc(C(O)O)c3OB2O)cc(F)c1CN |
| InChI | InChI=1S/C19H23BFN3O5/c21-15-5-10(4-12(8-22)14(15)9-23)6-17(25)24-16-7-11-2-1-3-13(19(26)27)18(11)29-20(16)28/h1-5,16,19,26-28H,6-9,22-23H2,(H,24,25) |
| InChIKey | OOLMMWVWULASFB-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.22 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|