About 1-(1-cyclohexa-1,3-dien-1-ylethyl)-3-methylurea
1-(1-cyclohexa-1,3-dien-1-ylethyl)-3-methylurea (PubChem CID 123258456) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-(1-cyclohexa-1,3-dien-1-ylethyl)-3-methylurea.
Molecular Properties
| Compound Name | 1-(1-cyclohexa-1,3-dien-1-ylethyl)-3-methylurea |
| PubChem CID | 123258456 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1-(1-cyclohexa-1,3-dien-1-ylethyl)-3-methylurea |
| SMILES | CNC(=O)NC(C)C1=CC=CCC1 |
| InChI | InChI=1S/C10H16N2O/c1-8(12-10(13)11-2)9-6-4-3-5-7-9/h3-4,6,8H,5,7H2,1-2H3,(H2,11,12,13) |
| InChIKey | QCNAUYOWUYGXNL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(1-cyclohexa-1,3-dien-1-ylethyl)-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-cyclohexa-1,3-dien-1-ylethyl)-3-methylurea?
The IUPAC name of 1-(1-cyclohexa-1,3-dien-1-ylethyl)-3-methylurea (CID 123258456) is 1-(1-cyclohexa-1,3-dien-1-ylethyl)-3-methylurea.
What is the SMILES notation for 1-(1-cyclohexa-1,3-dien-1-ylethyl)-3-methylurea?
The canonical SMILES for 1-(1-cyclohexa-1,3-dien-1-ylethyl)-3-methylurea is CNC(=O)NC(C)C1=CC=CCC1.
What is the InChIKey of 1-(1-cyclohexa-1,3-dien-1-ylethyl)-3-methylurea?
The InChIKey is QCNAUYOWUYGXNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c1-8(12-10(13)11-2)9-6-4-3-5-7-9/h3-4,6,8H,5,7H2,1-2H3,(H2,11,12,13).
What are the key properties of 1-(1-cyclohexa-1,3-dien-1-ylethyl)-3-methylurea?
1-(1-cyclohexa-1,3-dien-1-ylethyl)-3-methylurea has a molecular weight of 180.25 g/mol, XLogP of 1.58, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-cyclohexa-1,3-dien-1-ylethyl)-3-methylurea is sourced from PubChem (CID 123258456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).