About N'-(1-amino-2,2-dimethylpropylidene)-N-propan-2-yloxamide
N'-(1-amino-2,2-dimethylpropylidene)-N-propan-2-yloxamide (PubChem CID 123259599) has the molecular formula C10H19N3O2
and a molecular weight of 213.28 g/mol. Its IUPAC name is N'-(1-amino-2,2-dimethylpropylidene)-N-propan-2-yloxamide.
Molecular Properties
| Compound Name | N'-(1-amino-2,2-dimethylpropylidene)-N-propan-2-yloxamide |
| PubChem CID | 123259599 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | N'-(1-amino-2,2-dimethylpropylidene)-N-propan-2-yloxamide |
| SMILES | CC(C)NC(=O)C(=O)/N=C(\N)C(C)(C)C |
| InChI | InChI=1S/C10H19N3O2/c1-6(2)12-7(14)8(15)13-9(11)10(3,4)5/h6H,1-5H3,(H,12,14)(H2,11,13,15) |
| InChIKey | DWFCOYYMCLXWQN-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(1-amino-2,2-dimethylpropylidene)-N-propan-2-yloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1-amino-2,2-dimethylpropylidene)-N-propan-2-yloxamide?
The IUPAC name of N'-(1-amino-2,2-dimethylpropylidene)-N-propan-2-yloxamide (CID 123259599) is N'-(1-amino-2,2-dimethylpropylidene)-N-propan-2-yloxamide.
What is the SMILES notation for N'-(1-amino-2,2-dimethylpropylidene)-N-propan-2-yloxamide?
The canonical SMILES for N'-(1-amino-2,2-dimethylpropylidene)-N-propan-2-yloxamide is CC(C)NC(=O)C(=O)/N=C(\N)C(C)(C)C.
What is the InChIKey of N'-(1-amino-2,2-dimethylpropylidene)-N-propan-2-yloxamide?
The InChIKey is DWFCOYYMCLXWQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O2/c1-6(2)12-7(14)8(15)13-9(11)10(3,4)5/h6H,1-5H3,(H,12,14)(H2,11,13,15).
What are the key properties of N'-(1-amino-2,2-dimethylpropylidene)-N-propan-2-yloxamide?
N'-(1-amino-2,2-dimethylpropylidene)-N-propan-2-yloxamide has a molecular weight of 213.28 g/mol, XLogP of 0.44, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1-amino-2,2-dimethylpropylidene)-N-propan-2-yloxamide is sourced from PubChem (CID 123259599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).