C39H46N2O2+2 — CID 123260120
7,9-bis(2,6-diethylphenyl)-8-methyl-8H-acenaphthyleno[1,2-d]imidazole-7,9-diium;methyl 2-methylpropanoate (PubChem CID 123260120) has the molecular formula C39H46N2O2+2 and a molecular weight of 574.81 g/mol. Its IUPAC name is 7,9-bis(2,6-diethylphenyl)-8-methyl-8H-acenaphthyleno[1,2-d]imidazole-7,9-diium;methyl 2-methylpropanoate.
| Compound Name | 7,9-bis(2,6-diethylphenyl)-8-methyl-8H-acenaphthyleno[1,2-d]imidazole-7,9-diium;methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 123260120 |
| Molecular Formula | C39H46N2O2+2 |
| Molecular Weight | 574.81 g/mol |
| Exact Mass | 574.35 |
| IUPAC Name | 7,9-bis(2,6-diethylphenyl)-8-methyl-8H-acenaphthyleno[1,2-d]imidazole-7,9-diium;methyl 2-methylpropanoate |
| SMILES | CCc1cccc(CC)c1[N+]1=C2C(=[N+](c3c(CC)cccc3CC)C1C)c1cccc3cccc2c13.COC(=O)C(C)C |
| InChI | InChI=1S/C34H36N2.C5H10O2/c1-6-23-14-10-15-24(7-2)31(23)35-22(5)36(32-25(8-3)16-11-17-26(32)9-4)34-29-21-13-19-27-18-12-20-28(30(27)29)33(34)35;1-4(2)5(6)7-3/h10-22H,6-9H2,1-5H3;4H,1-3H3/q+2; |
| InChIKey | HEQXOHMNXMAMIX-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 32.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.81 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|