C28H38N4O3Si — CID 123260398
2-[4-[4-[5-[5-methyl-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-2-pyridinyl]phenyl]cyclohexyl]acetic acid (PubChem CID 123260398) has the molecular formula C28H38N4O3Si and a molecular weight of 506.72 g/mol. Its IUPAC name is 2-[4-[4-[5-[5-methyl-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-2-pyridinyl]phenyl]cyclohexyl]acetic acid.
| Compound Name | 2-[4-[4-[5-[5-methyl-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-2-pyridinyl]phenyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 123260398 |
| Molecular Formula | C28H38N4O3Si |
| Molecular Weight | 506.72 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | 2-[4-[4-[5-[5-methyl-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-2-pyridinyl]phenyl]cyclohexyl]acetic acid |
| SMILES | Cc1nc(-c2ccc(-c3ccc(C4CCC(CC(=O)O)CC4)cc3)nc2)n(COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C28H38N4O3Si/c1-20-30-28(32(31-20)19-35-15-16-36(2,3)4)25-13-14-26(29-18-25)24-11-9-23(10-12-24)22-7-5-21(6-8-22)17-27(33)34/h9-14,18,21-22H,5-8,15-17,19H2,1-4H3,(H,33,34) |
| InChIKey | MXTRDFBKOROTER-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.72 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|