C27H30N4O2Si — CID 123260407
N-(3,5-dimethoxyphenyl)-3-(1-methylpyrazol-4-yl)-N-(3-trimethylsilylprop-2-ynyl)quinolin-6-amine (PubChem CID 123260407) has the molecular formula C27H30N4O2Si and a molecular weight of 470.65 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-3-(1-methylpyrazol-4-yl)-N-(3-trimethylsilylprop-2-ynyl)quinolin-6-amine.
| Compound Name | N-(3,5-dimethoxyphenyl)-3-(1-methylpyrazol-4-yl)-N-(3-trimethylsilylprop-2-ynyl)quinolin-6-amine |
|---|---|
| PubChem CID | 123260407 |
| Molecular Formula | C27H30N4O2Si |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-3-(1-methylpyrazol-4-yl)-N-(3-trimethylsilylprop-2-ynyl)quinolin-6-amine |
| SMILES | COc1cc(OC)cc(N(CC#C[Si](C)(C)C)c2ccc3ncc(-c4cnn(C)c4)cc3c2)c1 |
| InChI | InChI=1S/C27H30N4O2Si/c1-30-19-22(18-29-30)21-12-20-13-23(8-9-27(20)28-17-21)31(10-7-11-34(4,5)6)24-14-25(32-2)16-26(15-24)33-3/h8-9,12-19H,10H2,1-6H3 |
| InChIKey | VFQPYWSRPPVYIS-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|