C19H25N5O4S — CID 123260831
tert-butyl-[[1-[6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-4-yl]piperidin-4-yl]methyl]carbamic acid (PubChem CID 123260831) has the molecular formula C19H25N5O4S and a molecular weight of 419.51 g/mol. Its IUPAC name is tert-butyl-[[1-[6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-4-yl]piperidin-4-yl]methyl]carbamic acid.
| Compound Name | tert-butyl-[[1-[6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-4-yl]piperidin-4-yl]methyl]carbamic acid |
|---|---|
| PubChem CID | 123260831 |
| Molecular Formula | C19H25N5O4S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | tert-butyl-[[1-[6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-4-yl]piperidin-4-yl]methyl]carbamic acid |
| SMILES | CC(C)(C)N(CC1CCN(c2cc(C=C3SC(=O)NC3=O)ncn2)CC1)C(=O)O |
| InChI | InChI=1S/C19H25N5O4S/c1-19(2,3)24(18(27)28)10-12-4-6-23(7-5-12)15-9-13(20-11-21-15)8-14-16(25)22-17(26)29-14/h8-9,11-12H,4-7,10H2,1-3H3,(H,27,28)(H,22,25,26) |
| InChIKey | KCBRVBLBPJUQMC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|