C7H8N2 — CID 123260837
N-methylpenta-2,4-dienimidoyl cyanide (PubChem CID 123260837) has the molecular formula C7H8N2 and a molecular weight of 120.15 g/mol. Its IUPAC name is N-methylpenta-2,4-dienimidoyl cyanide.
| Compound Name | N-methylpenta-2,4-dienimidoyl cyanide |
|---|---|
| PubChem CID | 123260837 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | N-methylpenta-2,4-dienimidoyl cyanide |
| SMILES | C=CC=C/C(C#N)=N/C |
| InChI | InChI=1S/C7H8N2/c1-3-4-5-7(6-8)9-2/h3-5H,1H2,2H3/b5-4?,9-7- |
| InChIKey | MDYOFBBQVWAPPJ-HFOWNTLMSA-N |
| XLogP | 1.32 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|