C35H52F5NO2 — CID 123261531
4-[2-[4-[[[3-[2-(difluoromethyl)-3-methylidene-2,3a,4,5,6,7-hexahydro-1H-azulen-1-yl]-4-methylcyclohexyl]-hydroxymethyl]amino]-2-(trifluoromethyl)cyclohexyl]ethylidene]cyclohexan-1-ol (PubChem CID 123261531) has the molecular formula C35H52F5NO2 and a molecular weight of 613.80 g/mol. Its IUPAC name is 4-[2-[4-[[[3-[2-(difluoromethyl)-3-methylidene-2,3a,4,5,6,7-hexahydro-1H-azulen-1-yl]-4-methylcyclohexyl]-hydroxymethyl]amino]-2-(trifluoromethyl)cyclohexyl]ethylidene]cyclohexan-1-ol.
| Compound Name | 4-[2-[4-[[[3-[2-(difluoromethyl)-3-methylidene-2,3a,4,5,6,7-hexahydro-1H-azulen-1-yl]-4-methylcyclohexyl]-hydroxymethyl]amino]-2-(trifluoromethyl)cyclohexyl]ethylidene]cyclohexan-1-ol |
|---|---|
| PubChem CID | 123261531 |
| Molecular Formula | C35H52F5NO2 |
| Molecular Weight | 613.80 g/mol |
| Exact Mass | 613.39 |
| IUPAC Name | 4-[2-[4-[[[3-[2-(difluoromethyl)-3-methylidene-2,3a,4,5,6,7-hexahydro-1H-azulen-1-yl]-4-methylcyclohexyl]-hydroxymethyl]amino]-2-(trifluoromethyl)cyclohexyl]ethylidene]cyclohexan-1-ol |
| SMILES | C=C1C2CCCCC=C2C(C2CC(C(O)NC3CCC(CC=C4CCC(O)CC4)C(C(F)(F)F)C3)CCC2C)C1C(F)F |
| InChI | InChI=1S/C35H52F5NO2/c1-20-8-12-24(18-29(20)32-28-7-5-3-4-6-27(28)21(2)31(32)33(36)37)34(43)41-25-15-14-23(30(19-25)35(38,39)40)13-9-22-10-16-26(42)17-11-22/h7,9,20,23-27,29-34,41-43H,2-6,8,10-19H2,1H3/b22-9- |
| InChIKey | JJLZCDIVUJCNLX-AFPJDJCSSA-N |
| XLogP | 8.73 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.80 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|