C23H41NO3 — CID 123261555
5-[2,5-dihydroxy-3-(2-propylheptyl)pyrrol-1-yl]-3,3,5-trimethylhexan-2-one (PubChem CID 123261555) has the molecular formula C23H41NO3 and a molecular weight of 379.59 g/mol. Its IUPAC name is 5-[2,5-dihydroxy-3-(2-propylheptyl)pyrrol-1-yl]-3,3,5-trimethylhexan-2-one.
| Compound Name | 5-[2,5-dihydroxy-3-(2-propylheptyl)pyrrol-1-yl]-3,3,5-trimethylhexan-2-one |
|---|---|
| PubChem CID | 123261555 |
| Molecular Formula | C23H41NO3 |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.31 |
| IUPAC Name | 5-[2,5-dihydroxy-3-(2-propylheptyl)pyrrol-1-yl]-3,3,5-trimethylhexan-2-one |
| SMILES | CCCCCC(CCC)Cc1cc(O)n(C(C)(C)CC(C)(C)C(C)=O)c1O |
| InChI | InChI=1S/C23H41NO3/c1-8-10-11-13-18(12-9-2)14-19-15-20(26)24(21(19)27)23(6,7)16-22(4,5)17(3)25/h15,18,26-27H,8-14,16H2,1-7H3 |
| InChIKey | GHHXMZNCMGXSEL-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|