C15H13F4NO2 — CID 123261653
1-methyl-3-[(2,3,4,6-tetrafluoro-5-prop-2-enylphenyl)methyl]pyrrole-2,5-diol (PubChem CID 123261653) has the molecular formula C15H13F4NO2 and a molecular weight of 315.27 g/mol. Its IUPAC name is 1-methyl-3-[(2,3,4,6-tetrafluoro-5-prop-2-enylphenyl)methyl]pyrrole-2,5-diol.
| Compound Name | 1-methyl-3-[(2,3,4,6-tetrafluoro-5-prop-2-enylphenyl)methyl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 123261653 |
| Molecular Formula | C15H13F4NO2 |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 1-methyl-3-[(2,3,4,6-tetrafluoro-5-prop-2-enylphenyl)methyl]pyrrole-2,5-diol |
| SMILES | C=CCc1c(F)c(F)c(F)c(Cc2cc(O)n(C)c2O)c1F |
| InChI | InChI=1S/C15H13F4NO2/c1-3-4-8-11(16)9(13(18)14(19)12(8)17)5-7-6-10(21)20(2)15(7)22/h3,6,21-22H,1,4-5H2,2H3 |
| InChIKey | UPEINXHFLQYQGV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|