About hydroxy(dimethoxy)silane
hydroxy(dimethoxy)silane (PubChem CID 123261864) has the molecular formula C2H8O3Si
and a molecular weight of 108.17 g/mol. Its IUPAC name is hydroxy(dimethoxy)silane.
Molecular Properties
| Compound Name | hydroxy(dimethoxy)silane |
| PubChem CID | 123261864 |
| Molecular Formula | C2H8O3Si |
| Molecular Weight | 108.17 g/mol |
| Exact Mass | 108.02 |
| IUPAC Name | hydroxy(dimethoxy)silane |
| SMILES | CO[SiH](O)OC |
| InChI | InChI=1S/C2H8O3Si/c1-4-6(3)5-2/h3,6H,1-2H3 |
| InChIKey | OTFZCHYTCGAREX-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.17 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze hydroxy(dimethoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy(dimethoxy)silane?
The IUPAC name of hydroxy(dimethoxy)silane (CID 123261864) is hydroxy(dimethoxy)silane.
What is the SMILES notation for hydroxy(dimethoxy)silane?
The canonical SMILES for hydroxy(dimethoxy)silane is CO[SiH](O)OC.
What is the InChIKey of hydroxy(dimethoxy)silane?
The InChIKey is OTFZCHYTCGAREX-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H8O3Si/c1-4-6(3)5-2/h3,6H,1-2H3.
What are the key properties of hydroxy(dimethoxy)silane?
hydroxy(dimethoxy)silane has a molecular weight of 108.17 g/mol, XLogP of -1.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy(dimethoxy)silane is sourced from PubChem (CID 123261864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).