About 3,5-dimethyl-1-(6-methylcyclohepta-1,6-dien-1-yl)piperazine
3,5-dimethyl-1-(6-methylcyclohepta-1,6-dien-1-yl)piperazine (PubChem CID 123262129) has the molecular formula C14H24N2
and a molecular weight of 220.36 g/mol. Its IUPAC name is 3,5-dimethyl-1-(6-methylcyclohepta-1,6-dien-1-yl)piperazine.
Molecular Properties
| Compound Name | 3,5-dimethyl-1-(6-methylcyclohepta-1,6-dien-1-yl)piperazine |
| PubChem CID | 123262129 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 3,5-dimethyl-1-(6-methylcyclohepta-1,6-dien-1-yl)piperazine |
| SMILES | CC1=CC(N2CC(C)NC(C)C2)=CCCC1 |
| InChI | InChI=1S/C14H24N2/c1-11-6-4-5-7-14(8-11)16-9-12(2)15-13(3)10-16/h7-8,12-13,15H,4-6,9-10H2,1-3H3 |
| InChIKey | PRSDDKXASSDCLP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dimethyl-1-(6-methylcyclohepta-1,6-dien-1-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1-(6-methylcyclohepta-1,6-dien-1-yl)piperazine?
The IUPAC name of 3,5-dimethyl-1-(6-methylcyclohepta-1,6-dien-1-yl)piperazine (CID 123262129) is 3,5-dimethyl-1-(6-methylcyclohepta-1,6-dien-1-yl)piperazine.
What is the SMILES notation for 3,5-dimethyl-1-(6-methylcyclohepta-1,6-dien-1-yl)piperazine?
The canonical SMILES for 3,5-dimethyl-1-(6-methylcyclohepta-1,6-dien-1-yl)piperazine is CC1=CC(N2CC(C)NC(C)C2)=CCCC1.
What is the InChIKey of 3,5-dimethyl-1-(6-methylcyclohepta-1,6-dien-1-yl)piperazine?
The InChIKey is PRSDDKXASSDCLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2/c1-11-6-4-5-7-14(8-11)16-9-12(2)15-13(3)10-16/h7-8,12-13,15H,4-6,9-10H2,1-3H3.
What are the key properties of 3,5-dimethyl-1-(6-methylcyclohepta-1,6-dien-1-yl)piperazine?
3,5-dimethyl-1-(6-methylcyclohepta-1,6-dien-1-yl)piperazine has a molecular weight of 220.36 g/mol, XLogP of 2.68, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1-(6-methylcyclohepta-1,6-dien-1-yl)piperazine is sourced from PubChem (CID 123262129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).