C26H25FN4O3 — CID 123262296
4-(7-fluorocyclohepta-1,3,6-trien-1-yl)-4-(methoxymethoxy)-1-[5-(1-methylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]hex-2-yn-1-one (PubChem CID 123262296) has the molecular formula C26H25FN4O3 and a molecular weight of 460.51 g/mol. Its IUPAC name is 4-(7-fluorocyclohepta-1,3,6-trien-1-yl)-4-(methoxymethoxy)-1-[5-(1-methylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]hex-2-yn-1-one.
| Compound Name | 4-(7-fluorocyclohepta-1,3,6-trien-1-yl)-4-(methoxymethoxy)-1-[5-(1-methylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]hex-2-yn-1-one |
|---|---|
| PubChem CID | 123262296 |
| Molecular Formula | C26H25FN4O3 |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 4-(7-fluorocyclohepta-1,3,6-trien-1-yl)-4-(methoxymethoxy)-1-[5-(1-methylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]hex-2-yn-1-one |
| SMILES | CCC(C#CC(=O)c1c[nH]c2ncc(-c3cnn(C)c3)cc12)(OCOC)C1=CC=CCC=C1F |
| InChI | InChI=1S/C26H25FN4O3/c1-4-26(34-17-33-3,22-8-6-5-7-9-23(22)27)11-10-24(32)21-15-29-25-20(21)12-18(13-28-25)19-14-30-31(2)16-19/h5-6,8-9,12-16H,4,7,17H2,1-3H3,(H,28,29) |
| InChIKey | LNOBRXOJYYIRPR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|