C18H32N6O2 — CID 123262866
(3S,4R)-1-[4-imino-2-(3-methyl-1,2,4-oxadiazol-5-yl)pentanimidoyl]-3-methoxy-N-(2-methylpropyl)piperidin-4-amine (PubChem CID 123262866) has the molecular formula C18H32N6O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is (3S,4R)-1-[4-imino-2-(3-methyl-1,2,4-oxadiazol-5-yl)pentanimidoyl]-3-methoxy-N-(2-methylpropyl)piperidin-4-amine.
| Compound Name | (3S,4R)-1-[4-imino-2-(3-methyl-1,2,4-oxadiazol-5-yl)pentanimidoyl]-3-methoxy-N-(2-methylpropyl)piperidin-4-amine |
|---|---|
| PubChem CID | 123262866 |
| Molecular Formula | C18H32N6O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | (3S,4R)-1-[4-imino-2-(3-methyl-1,2,4-oxadiazol-5-yl)pentanimidoyl]-3-methoxy-N-(2-methylpropyl)piperidin-4-amine |
| SMILES | [H]/N=C(/C(C/C(C)=N/[H])c1nc(C)no1)N1CC[C@@H](NCC(C)C)[C@@H](OC)C1 |
| InChI | InChI=1S/C18H32N6O2/c1-11(2)9-21-15-6-7-24(10-16(15)25-5)17(20)14(8-12(3)19)18-22-13(4)23-26-18/h11,14-16,19-21H,6-10H2,1-5H3/b19-12+,20-17-/t14?,15-,16+/m1/s1 |
| InChIKey | SBVPJYOFHWATFE-DJJJRNIUSA-N |
| XLogP | 2.20 |
| TPSA | 111.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|