C15H26O5SSi — CID 123263416
2-trimethylsilylethyl 7-acetylsulfanyl-3-formyloxyhept-4-enoate (PubChem CID 123263416) has the molecular formula C15H26O5SSi and a molecular weight of 346.52 g/mol. Its IUPAC name is 2-trimethylsilylethyl 7-acetylsulfanyl-3-formyloxyhept-4-enoate.
| Compound Name | 2-trimethylsilylethyl 7-acetylsulfanyl-3-formyloxyhept-4-enoate |
|---|---|
| PubChem CID | 123263416 |
| Molecular Formula | C15H26O5SSi |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 2-trimethylsilylethyl 7-acetylsulfanyl-3-formyloxyhept-4-enoate |
| SMILES | CC(=O)SCCC=CC(CC(=O)OCC[Si](C)(C)C)OC=O |
| InChI | InChI=1S/C15H26O5SSi/c1-13(17)21-9-6-5-7-14(20-12-16)11-15(18)19-8-10-22(2,3)4/h5,7,12,14H,6,8-11H2,1-4H3 |
| InChIKey | PHVYTTYSQXLAOB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|