About 2-trimethylsilylethyl 7-acetylsulfanyl-3-formyloxyhept-4-enoate
2-trimethylsilylethyl 7-acetylsulfanyl-3-formyloxyhept-4-enoate (PubChem CID 123263416) has the molecular formula C15H26O5SSi
and a molecular weight of 346.52 g/mol. Its IUPAC name is 2-trimethylsilylethyl 7-acetylsulfanyl-3-formyloxyhept-4-enoate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl 7-acetylsulfanyl-3-formyloxyhept-4-enoate |
| PubChem CID | 123263416 |
| Molecular Formula | C15H26O5SSi |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 2-trimethylsilylethyl 7-acetylsulfanyl-3-formyloxyhept-4-enoate |
| SMILES | CC(=O)SCCC=CC(CC(=O)OCC[Si](C)(C)C)OC=O |
| InChI | InChI=1S/C15H26O5SSi/c1-13(17)21-9-6-5-7-14(20-12-16)11-15(18)19-8-10-22(2,3)4/h5,7,12,14H,6,8-11H2,1-4H3 |
| InChIKey | PHVYTTYSQXLAOB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl 7-acetylsulfanyl-3-formyloxyhept-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl 7-acetylsulfanyl-3-formyloxyhept-4-enoate?
The IUPAC name of 2-trimethylsilylethyl 7-acetylsulfanyl-3-formyloxyhept-4-enoate (CID 123263416) is 2-trimethylsilylethyl 7-acetylsulfanyl-3-formyloxyhept-4-enoate.
What is the SMILES notation for 2-trimethylsilylethyl 7-acetylsulfanyl-3-formyloxyhept-4-enoate?
The canonical SMILES for 2-trimethylsilylethyl 7-acetylsulfanyl-3-formyloxyhept-4-enoate is CC(=O)SCCC=CC(CC(=O)OCC[Si](C)(C)C)OC=O.
What is the InChIKey of 2-trimethylsilylethyl 7-acetylsulfanyl-3-formyloxyhept-4-enoate?
The InChIKey is PHVYTTYSQXLAOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O5SSi/c1-13(17)21-9-6-5-7-14(20-12-16)11-15(18)19-8-10-22(2,3)4/h5,7,12,14H,6,8-11H2,1-4H3.
What are the key properties of 2-trimethylsilylethyl 7-acetylsulfanyl-3-formyloxyhept-4-enoate?
2-trimethylsilylethyl 7-acetylsulfanyl-3-formyloxyhept-4-enoate has a molecular weight of 346.52 g/mol, XLogP of 3.03, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl 7-acetylsulfanyl-3-formyloxyhept-4-enoate is sourced from PubChem (CID 123263416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).