C19H23N7OS — CID 123263660
8-cyclopentyl-2-[1,3-diimino-1-(1,3-thiazol-4-yl)propan-2-yl]-7-ethyl-5,7-dihydropteridin-6-one (PubChem CID 123263660) has the molecular formula C19H23N7OS and a molecular weight of 397.51 g/mol. Its IUPAC name is 8-cyclopentyl-2-[1,3-diimino-1-(1,3-thiazol-4-yl)propan-2-yl]-7-ethyl-5,7-dihydropteridin-6-one.
| Compound Name | 8-cyclopentyl-2-[1,3-diimino-1-(1,3-thiazol-4-yl)propan-2-yl]-7-ethyl-5,7-dihydropteridin-6-one |
|---|---|
| PubChem CID | 123263660 |
| Molecular Formula | C19H23N7OS |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 8-cyclopentyl-2-[1,3-diimino-1-(1,3-thiazol-4-yl)propan-2-yl]-7-ethyl-5,7-dihydropteridin-6-one |
| SMILES | [H]/N=C(\c1cscn1)C(/C=N/[H])c1ncc2c(n1)N(C1CCCC1)C(CC)C(=O)N2 |
| InChI | InChI=1S/C19H23N7OS/c1-2-15-19(27)24-13-8-22-17(12(7-20)16(21)14-9-28-10-23-14)25-18(13)26(15)11-5-3-4-6-11/h7-12,15,20-21H,2-6H2,1H3,(H,24,27)/b20-7+,21-16- |
| InChIKey | AECGAZXRPQKHFB-LSMNCDAZSA-N |
| XLogP | 3.21 |
| TPSA | 118.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|