About 1-[4-(2,5-dihydroxy-3-methylpyrrol-1-yl)phenyl]-3-methylpyrrole-2,5-diol
1-[4-(2,5-dihydroxy-3-methylpyrrol-1-yl)phenyl]-3-methylpyrrole-2,5-diol (PubChem CID 123264530) has the molecular formula C16H16N2O4
and a molecular weight of 300.31 g/mol. Its IUPAC name is 1-[4-(2,5-dihydroxy-3-methylpyrrol-1-yl)phenyl]-3-methylpyrrole-2,5-diol.
Molecular Properties
| Compound Name | 1-[4-(2,5-dihydroxy-3-methylpyrrol-1-yl)phenyl]-3-methylpyrrole-2,5-diol |
| PubChem CID | 123264530 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 1-[4-(2,5-dihydroxy-3-methylpyrrol-1-yl)phenyl]-3-methylpyrrole-2,5-diol |
| SMILES | Cc1cc(O)n(-c2ccc(-n3c(O)cc(C)c3O)cc2)c1O |
| InChI | InChI=1S/C16H16N2O4/c1-9-7-13(19)17(15(9)21)11-3-5-12(6-4-11)18-14(20)8-10(2)16(18)22/h3-8,19-22H,1-2H3 |
| InChIKey | GUTXQXZESRVXKA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 90.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-(2,5-dihydroxy-3-methylpyrrol-1-yl)phenyl]-3-methylpyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2,5-dihydroxy-3-methylpyrrol-1-yl)phenyl]-3-methylpyrrole-2,5-diol?
The IUPAC name of 1-[4-(2,5-dihydroxy-3-methylpyrrol-1-yl)phenyl]-3-methylpyrrole-2,5-diol (CID 123264530) is 1-[4-(2,5-dihydroxy-3-methylpyrrol-1-yl)phenyl]-3-methylpyrrole-2,5-diol.
What is the SMILES notation for 1-[4-(2,5-dihydroxy-3-methylpyrrol-1-yl)phenyl]-3-methylpyrrole-2,5-diol?
The canonical SMILES for 1-[4-(2,5-dihydroxy-3-methylpyrrol-1-yl)phenyl]-3-methylpyrrole-2,5-diol is Cc1cc(O)n(-c2ccc(-n3c(O)cc(C)c3O)cc2)c1O.
What is the InChIKey of 1-[4-(2,5-dihydroxy-3-methylpyrrol-1-yl)phenyl]-3-methylpyrrole-2,5-diol?
The InChIKey is GUTXQXZESRVXKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O4/c1-9-7-13(19)17(15(9)21)11-3-5-12(6-4-11)18-14(20)8-10(2)16(18)22/h3-8,19-22H,1-2H3.
What are the key properties of 1-[4-(2,5-dihydroxy-3-methylpyrrol-1-yl)phenyl]-3-methylpyrrole-2,5-diol?
1-[4-(2,5-dihydroxy-3-methylpyrrol-1-yl)phenyl]-3-methylpyrrole-2,5-diol has a molecular weight of 300.31 g/mol, XLogP of 2.71, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2,5-dihydroxy-3-methylpyrrol-1-yl)phenyl]-3-methylpyrrole-2,5-diol is sourced from PubChem (CID 123264530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).