C20H29N5O2 — CID 123265243
6-(1-cyclobutylethylamino)-7-[(4-methylcyclohexyl)methyl]purine-2-carboxylic acid (PubChem CID 123265243) has the molecular formula C20H29N5O2 and a molecular weight of 371.49 g/mol. Its IUPAC name is 6-(1-cyclobutylethylamino)-7-[(4-methylcyclohexyl)methyl]purine-2-carboxylic acid.
| Compound Name | 6-(1-cyclobutylethylamino)-7-[(4-methylcyclohexyl)methyl]purine-2-carboxylic acid |
|---|---|
| PubChem CID | 123265243 |
| Molecular Formula | C20H29N5O2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | 6-(1-cyclobutylethylamino)-7-[(4-methylcyclohexyl)methyl]purine-2-carboxylic acid |
| SMILES | CC1CCC(Cn2cnc3nc(C(=O)O)nc(NC(C)C4CCC4)c32)CC1 |
| InChI | InChI=1S/C20H29N5O2/c1-12-6-8-14(9-7-12)10-25-11-21-17-16(25)18(24-19(23-17)20(26)27)22-13(2)15-4-3-5-15/h11-15H,3-10H2,1-2H3,(H,26,27)(H,22,23,24) |
| InChIKey | YHQMOLZVYNQBNN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |