About 3-pyrazolo[1,5-c]pyrimidin-2-ylprop-2-en-1-imine
3-pyrazolo[1,5-c]pyrimidin-2-ylprop-2-en-1-imine (PubChem CID 123265279) has the molecular formula C9H8N4
and a molecular weight of 172.19 g/mol. Its IUPAC name is 3-pyrazolo[1,5-c]pyrimidin-2-ylprop-2-en-1-imine.
Molecular Properties
| Compound Name | 3-pyrazolo[1,5-c]pyrimidin-2-ylprop-2-en-1-imine |
| PubChem CID | 123265279 |
| Molecular Formula | C9H8N4 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 3-pyrazolo[1,5-c]pyrimidin-2-ylprop-2-en-1-imine |
| SMILES | [H]/N=C/C=Cc1cc2ccncn2n1 |
| InChI | InChI=1S/C9H8N4/c10-4-1-2-8-6-9-3-5-11-7-13(9)12-8/h1-7,10H/b2-1?,10-4+ |
| InChIKey | SBWJLLCCYGCZIP-KIHWBLKRSA-N |
| XLogP | 1.39 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-pyrazolo[1,5-c]pyrimidin-2-ylprop-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrazolo[1,5-c]pyrimidin-2-ylprop-2-en-1-imine?
The IUPAC name of 3-pyrazolo[1,5-c]pyrimidin-2-ylprop-2-en-1-imine (CID 123265279) is 3-pyrazolo[1,5-c]pyrimidin-2-ylprop-2-en-1-imine.
What is the SMILES notation for 3-pyrazolo[1,5-c]pyrimidin-2-ylprop-2-en-1-imine?
The canonical SMILES for 3-pyrazolo[1,5-c]pyrimidin-2-ylprop-2-en-1-imine is [H]/N=C/C=Cc1cc2ccncn2n1.
What is the InChIKey of 3-pyrazolo[1,5-c]pyrimidin-2-ylprop-2-en-1-imine?
The InChIKey is SBWJLLCCYGCZIP-KIHWBLKRSA-N. The full InChI is InChI=1S/C9H8N4/c10-4-1-2-8-6-9-3-5-11-7-13(9)12-8/h1-7,10H/b2-1?,10-4+.
What are the key properties of 3-pyrazolo[1,5-c]pyrimidin-2-ylprop-2-en-1-imine?
3-pyrazolo[1,5-c]pyrimidin-2-ylprop-2-en-1-imine has a molecular weight of 172.19 g/mol, XLogP of 1.39, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrazolo[1,5-c]pyrimidin-2-ylprop-2-en-1-imine is sourced from PubChem (CID 123265279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).