C16H18F2O4S — CID 123265292
3-[(3S,4R)-3,4-difluorocyclopentyl]-2-(4-ethylsulfonylphenyl)prop-2-enoic acid (PubChem CID 123265292) has the molecular formula C16H18F2O4S and a molecular weight of 344.38 g/mol. Its IUPAC name is 3-[(3S,4R)-3,4-difluorocyclopentyl]-2-(4-ethylsulfonylphenyl)prop-2-enoic acid.
| Compound Name | 3-[(3S,4R)-3,4-difluorocyclopentyl]-2-(4-ethylsulfonylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 123265292 |
| Molecular Formula | C16H18F2O4S |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 3-[(3S,4R)-3,4-difluorocyclopentyl]-2-(4-ethylsulfonylphenyl)prop-2-enoic acid |
| SMILES | CCS(=O)(=O)c1ccc(C(=CC2C[C@@H](F)[C@@H](F)C2)C(=O)O)cc1 |
| InChI | InChI=1S/C16H18F2O4S/c1-2-23(21,22)12-5-3-11(4-6-12)13(16(19)20)7-10-8-14(17)15(18)9-10/h3-7,10,14-15H,2,8-9H2,1H3,(H,19,20)/t10?,14-,15+ |
| InChIKey | NERBOFMHVUZQOJ-BWXMKOSVSA-N |
| XLogP | 3.03 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|