C17H24FN5O4S — CID 123265312
4-[3-(2-fluoro-4-methylsulfonylanilino)-2-oxopyrrolidin-1-yl]-N'-hydroxypiperidine-1-carboximidamide (PubChem CID 123265312) has the molecular formula C17H24FN5O4S and a molecular weight of 413.48 g/mol. Its IUPAC name is 4-[3-(2-fluoro-4-methylsulfonylanilino)-2-oxopyrrolidin-1-yl]-N'-hydroxypiperidine-1-carboximidamide.
| Compound Name | 4-[3-(2-fluoro-4-methylsulfonylanilino)-2-oxopyrrolidin-1-yl]-N'-hydroxypiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 123265312 |
| Molecular Formula | C17H24FN5O4S |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 4-[3-(2-fluoro-4-methylsulfonylanilino)-2-oxopyrrolidin-1-yl]-N'-hydroxypiperidine-1-carboximidamide |
| SMILES | CS(=O)(=O)c1ccc(NC2CCN(C3CCN(C(N)=NO)CC3)C2=O)c(F)c1 |
| InChI | InChI=1S/C17H24FN5O4S/c1-28(26,27)12-2-3-14(13(18)10-12)20-15-6-9-23(16(15)24)11-4-7-22(8-5-11)17(19)21-25/h2-3,10-11,15,20,25H,4-9H2,1H3,(H2,19,21) |
| InChIKey | DLOKTLJCGONJFY-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 128.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|