About 3-(C,N-dimethylcarbonimidoyl)-4-(1-methoxyethyl)-1,3-oxazolidin-2-one
3-(C,N-dimethylcarbonimidoyl)-4-(1-methoxyethyl)-1,3-oxazolidin-2-one (PubChem CID 123265338) has the molecular formula C9H16N2O3
and a molecular weight of 200.24 g/mol. Its IUPAC name is 3-(C,N-dimethylcarbonimidoyl)-4-(1-methoxyethyl)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-(C,N-dimethylcarbonimidoyl)-4-(1-methoxyethyl)-1,3-oxazolidin-2-one |
| PubChem CID | 123265338 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 3-(C,N-dimethylcarbonimidoyl)-4-(1-methoxyethyl)-1,3-oxazolidin-2-one |
| SMILES | C/N=C(\C)N1C(=O)OCC1C(C)OC |
| InChI | InChI=1S/C9H16N2O3/c1-6(13-4)8-5-14-9(12)11(8)7(2)10-3/h6,8H,5H2,1-4H3/b10-7+ |
| InChIKey | MDFGQBXMWRFVQE-JXMROGBWSA-N |
| XLogP | 0.89 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(C,N-dimethylcarbonimidoyl)-4-(1-methoxyethyl)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(C,N-dimethylcarbonimidoyl)-4-(1-methoxyethyl)-1,3-oxazolidin-2-one?
The IUPAC name of 3-(C,N-dimethylcarbonimidoyl)-4-(1-methoxyethyl)-1,3-oxazolidin-2-one (CID 123265338) is 3-(C,N-dimethylcarbonimidoyl)-4-(1-methoxyethyl)-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-(C,N-dimethylcarbonimidoyl)-4-(1-methoxyethyl)-1,3-oxazolidin-2-one?
The canonical SMILES for 3-(C,N-dimethylcarbonimidoyl)-4-(1-methoxyethyl)-1,3-oxazolidin-2-one is C/N=C(\C)N1C(=O)OCC1C(C)OC.
What is the InChIKey of 3-(C,N-dimethylcarbonimidoyl)-4-(1-methoxyethyl)-1,3-oxazolidin-2-one?
The InChIKey is MDFGQBXMWRFVQE-JXMROGBWSA-N. The full InChI is InChI=1S/C9H16N2O3/c1-6(13-4)8-5-14-9(12)11(8)7(2)10-3/h6,8H,5H2,1-4H3/b10-7+.
What are the key properties of 3-(C,N-dimethylcarbonimidoyl)-4-(1-methoxyethyl)-1,3-oxazolidin-2-one?
3-(C,N-dimethylcarbonimidoyl)-4-(1-methoxyethyl)-1,3-oxazolidin-2-one has a molecular weight of 200.24 g/mol, XLogP of 0.89, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(C,N-dimethylcarbonimidoyl)-4-(1-methoxyethyl)-1,3-oxazolidin-2-one is sourced from PubChem (CID 123265338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).