C12H13F2NO5S — CID 123265381
(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 1,1-difluoropropane-1-sulfonate (PubChem CID 123265381) has the molecular formula C12H13F2NO5S and a molecular weight of 321.30 g/mol. Its IUPAC name is (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 1,1-difluoropropane-1-sulfonate.
| Compound Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 1,1-difluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 123265381 |
| Molecular Formula | C12H13F2NO5S |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 1,1-difluoropropane-1-sulfonate |
| SMILES | CCC(F)(F)S(=O)(=O)On1c(O)c2c(c1O)C1C=CC2C1 |
| InChI | InChI=1S/C12H13F2NO5S/c1-2-12(13,14)21(18,19)20-15-10(16)8-6-3-4-7(5-6)9(8)11(15)17/h3-4,6-7,16-17H,2,5H2,1H3 |
| InChIKey | KGHWNCPQDFJTON-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|