C11H27NSi — CID 123265449
N,N,2,2,4,4-hexamethyl-3-silylpentan-3-amine (PubChem CID 123265449) has the molecular formula C11H27NSi and a molecular weight of 201.43 g/mol. Its IUPAC name is N,N,2,2,4,4-hexamethyl-3-silylpentan-3-amine.
| Compound Name | N,N,2,2,4,4-hexamethyl-3-silylpentan-3-amine |
|---|---|
| PubChem CID | 123265449 |
| Molecular Formula | C11H27NSi |
| Molecular Weight | 201.43 g/mol |
| Exact Mass | 201.19 |
| IUPAC Name | N,N,2,2,4,4-hexamethyl-3-silylpentan-3-amine |
| SMILES | CN(C)C([SiH3])(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H27NSi/c1-9(2,3)11(13,12(7)8)10(4,5)6/h1-8,13H3 |
| InChIKey | KRMAUSGRKXJVGJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.43 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|