C25H31NO5 — CID 123265602
9-hydroxy-6-(methoxymethyl)-7,8-bis(phenylmethoxy)-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-one (PubChem CID 123265602) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is 9-hydroxy-6-(methoxymethyl)-7,8-bis(phenylmethoxy)-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-one.
| Compound Name | 9-hydroxy-6-(methoxymethyl)-7,8-bis(phenylmethoxy)-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-one |
|---|---|
| PubChem CID | 123265602 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 9-hydroxy-6-(methoxymethyl)-7,8-bis(phenylmethoxy)-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-one |
| SMILES | COCC1C(OCc2ccccc2)C(OCc2ccccc2)C(O)C2CC(=O)CCN21 |
| InChI | InChI=1S/C25H31NO5/c1-29-17-22-24(30-15-18-8-4-2-5-9-18)25(31-16-19-10-6-3-7-11-19)23(28)21-14-20(27)12-13-26(21)22/h2-11,21-25,28H,12-17H2,1H3 |
| InChIKey | RPNUWARFIQXEON-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |