C21H38F2O4Si — CID 123266005
(3aR,4R,5R,6aS)-4-[(1R)-4-tert-butyl-1-dimethylsilyloxy-5,5-difluorooctyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 123266005) has the molecular formula C21H38F2O4Si and a molecular weight of 420.61 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[(1R)-4-tert-butyl-1-dimethylsilyloxy-5,5-difluorooctyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-4-[(1R)-4-tert-butyl-1-dimethylsilyloxy-5,5-difluorooctyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 123266005 |
| Molecular Formula | C21H38F2O4Si |
| Molecular Weight | 420.61 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[(1R)-4-tert-butyl-1-dimethylsilyloxy-5,5-difluorooctyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCC(F)(F)C(CC[C@@H](O[SiH](C)C)[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1O)C(C)(C)C |
| InChI | InChI=1S/C21H38F2O4Si/c1-7-10-21(22,23)17(20(2,3)4)9-8-15(27-28(5)6)19-13-11-18(25)26-16(13)12-14(19)24/h13-17,19,24,28H,7-12H2,1-6H3/t13-,14+,15+,16-,17?,19+/m0/s1 |
| InChIKey | ZTZGZENLSGXUFV-PNDBYZPASA-N |
| XLogP | 4.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|