C46H36N4O — CID 123266108
2-[3-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)phenyl]ethanol (PubChem CID 123266108) has the molecular formula C46H36N4O and a molecular weight of 660.82 g/mol. Its IUPAC name is 2-[3-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)phenyl]ethanol.
| Compound Name | 2-[3-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 123266108 |
| Molecular Formula | C46H36N4O |
| Molecular Weight | 660.82 g/mol |
| Exact Mass | 660.29 |
| IUPAC Name | 2-[3-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)phenyl]ethanol |
| SMILES | OCCc1cccc(C2=c3ccc([nH]3)=C(c3ccccc3)c3ccc([nH]3)C(c3ccccc3)=c3ccc([nH]3)=C(c3ccccc3)c3ccc2[nH]3)c1 |
| InChI | InChI=1S/C46H36N4O/c51-28-27-30-11-10-18-34(29-30)46-41-25-23-39(49-41)44(32-14-6-2-7-15-32)37-21-19-35(47-37)43(31-12-4-1-5-13-31)36-20-22-38(48-36)45(33-16-8-3-9-17-33)40-24-26-42(46)50-40/h1-26,29,47-51H,27-28H2 |
| InChIKey | SZBFCGBXVQJRAZ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.82 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 1 |