C18H27BO3 — CID 123266875
2-(2-but-3-enoxy-4,5-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 123266875) has the molecular formula C18H27BO3 and a molecular weight of 302.22 g/mol. Its IUPAC name is 2-(2-but-3-enoxy-4,5-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(2-but-3-enoxy-4,5-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 123266875 |
| Molecular Formula | C18H27BO3 |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 2-(2-but-3-enoxy-4,5-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=CCCOc1cc(C)c(C)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H27BO3/c1-8-9-10-20-16-12-14(3)13(2)11-15(16)19-21-17(4,5)18(6,7)22-19/h8,11-12H,1,9-10H2,2-7H3 |
| InChIKey | XXWFDTMAYRQAMO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|